C17H25N3O3 — CID 131939950
N-[3-(dimethylcarbamoyl)-4-methoxyphenyl]-1-methylpiperidine-3-carboxamide (PubChem CID 131939950) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[3-(dimethylcarbamoyl)-4-methoxyphenyl]-1-methylpiperidine-3-carboxamide.
| Compound Name | N-[3-(dimethylcarbamoyl)-4-methoxyphenyl]-1-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 131939950 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[3-(dimethylcarbamoyl)-4-methoxyphenyl]-1-methylpiperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN(C)C2)cc1C(=O)N(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-19(2)17(22)14-10-13(7-8-15(14)23-4)18-16(21)12-6-5-9-20(3)11-12/h7-8,10,12H,5-6,9,11H2,1-4H3,(H,18,21) |
| InChIKey | LQSNDNOGTSPHOO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |