C14H18BrNO3 — CID 115150743
N-(3-bromo-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxamide (PubChem CID 115150743) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(3-bromo-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxamide.
| Compound Name | N-(3-bromo-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115150743 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(3-bromo-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCC(O)CC2)cc1Br |
| InChI | InChI=1S/C14H18BrNO3/c1-19-13-7-4-10(8-12(13)15)16-14(18)9-2-5-11(17)6-3-9/h4,7-9,11,17H,2-3,5-6H2,1H3,(H,16,18) |
| InChIKey | CEUKHYLTEGLKFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |