C22H27BrN2O5S — CID 3546890
N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]cyclohexanecarboxamide (PubChem CID 3546890) has the molecular formula C22H27BrN2O5S and a molecular weight of 511.44 g/mol. Its IUPAC name is N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3546890 |
| Molecular Formula | C22H27BrN2O5S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]cyclohexanecarboxamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)C3CCCCC3)ccc2OC)cc1Br |
| InChI | InChI=1S/C22H27BrN2O5S/c1-3-30-19-11-10-17(13-18(19)23)25-31(27,28)21-14-16(9-12-20(21)29-2)24-22(26)15-7-5-4-6-8-15/h9-15,25H,3-8H2,1-2H3,(H,24,26) |
| InChIKey | QZPMVKLYWZONNO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |