C19H17BrN2O5S2 — CID 26875602
N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 26875602) has the molecular formula C19H17BrN2O5S2 and a molecular weight of 497.39 g/mol. Its IUPAC name is N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26875602 |
| Molecular Formula | C19H17BrN2O5S2 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3cccs3)ccc2OC)cc1Br |
| InChI | InChI=1S/C19H17BrN2O5S2/c1-26-15-7-6-13(10-14(15)20)22-29(24,25)18-11-12(5-8-16(18)27-2)21-19(23)17-4-3-9-28-17/h3-11,22H,1-2H3,(H,21,23) |
| InChIKey | JHKIYCCWIYBVRD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |