C22H21BrN2O4S — CID 71771105
N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-2,6-dimethylbenzamide (PubChem CID 71771105) has the molecular formula C22H21BrN2O4S and a molecular weight of 489.39 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-2,6-dimethylbenzamide.
| Compound Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 71771105 |
| Molecular Formula | C22H21BrN2O4S |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-2,6-dimethylbenzamide |
| SMILES | COc1ccc(NC(=O)c2c(C)cccc2C)cc1S(=O)(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrN2O4S/c1-14-5-4-6-15(2)21(14)22(26)24-18-11-12-19(29-3)20(13-18)30(27,28)25-17-9-7-16(23)8-10-17/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | XKVSGUHGYBPGJV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |