C19H19BrN2O4S — CID 35745347
(2E,4E)-N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]hexa-2,4-dienamide (PubChem CID 35745347) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is (2E,4E)-N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 35745347 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | (2E,4E)-N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(OC)c(S(=O)(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-3-4-5-6-19(23)21-16-11-12-17(26-2)18(13-16)27(24,25)22-15-9-7-14(20)8-10-15/h3-13,22H,1-2H3,(H,21,23)/b4-3+,6-5+ |
| InChIKey | HDCXFBAXKKTWJY-VNKDHWASSA-N |
| XLogP | 4.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|