C18H15BrN2O5S — CID 25348399
N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]furan-3-carboxamide (PubChem CID 25348399) has the molecular formula C18H15BrN2O5S and a molecular weight of 451.30 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]furan-3-carboxamide.
| Compound Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 25348399 |
| Molecular Formula | C18H15BrN2O5S |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]furan-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccoc2)cc1S(=O)(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H15BrN2O5S/c1-25-16-7-6-15(20-18(22)12-8-9-26-11-12)10-17(16)27(23,24)21-14-4-2-13(19)3-5-14/h2-11,21H,1H3,(H,20,22) |
| InChIKey | RZBIQJDAPAENNB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |