C22H17BrN2O4S — CID 30285125
3-[(4-bromophenyl)sulfamoyl]-N-(3-ethynylphenyl)-4-methoxybenzamide (PubChem CID 30285125) has the molecular formula C22H17BrN2O4S and a molecular weight of 485.36 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfamoyl]-N-(3-ethynylphenyl)-4-methoxybenzamide.
| Compound Name | 3-[(4-bromophenyl)sulfamoyl]-N-(3-ethynylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 30285125 |
| Molecular Formula | C22H17BrN2O4S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 3-[(4-bromophenyl)sulfamoyl]-N-(3-ethynylphenyl)-4-methoxybenzamide |
| SMILES | C#Cc1cccc(NC(=O)c2ccc(OC)c(S(=O)(=O)Nc3ccc(Br)cc3)c2)c1 |
| InChI | InChI=1S/C22H17BrN2O4S/c1-3-15-5-4-6-19(13-15)24-22(26)16-7-12-20(29-2)21(14-16)30(27,28)25-18-10-8-17(23)9-11-18/h1,4-14,25H,2H3,(H,24,26) |
| InChIKey | JUYCHVFRGOAYTD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|