C17H16N2O4S — CID 18147880
N-(3-ethynylphenyl)-4-methoxy-3-(methylsulfamoyl)benzamide (PubChem CID 18147880) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-4-methoxy-3-(methylsulfamoyl)benzamide.
| Compound Name | N-(3-ethynylphenyl)-4-methoxy-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 18147880 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-(3-ethynylphenyl)-4-methoxy-3-(methylsulfamoyl)benzamide |
| SMILES | C#Cc1cccc(NC(=O)c2ccc(OC)c(S(=O)(=O)NC)c2)c1 |
| InChI | InChI=1S/C17H16N2O4S/c1-4-12-6-5-7-14(10-12)19-17(20)13-8-9-15(23-3)16(11-13)24(21,22)18-2/h1,5-11,18H,2-3H3,(H,19,20) |
| InChIKey | LSTVFNMYYFXCSY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|