C18H21FN2O4S — CID 26579178
3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-4-methoxybenzamide (PubChem CID 26579178) has the molecular formula C18H21FN2O4S and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-4-methoxybenzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 26579178 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(F)c2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H21FN2O4S/c1-18(2,3)21-26(23,24)16-10-12(8-9-15(16)25-4)17(22)20-14-7-5-6-13(19)11-14/h5-11,21H,1-4H3,(H,20,22) |
| InChIKey | WNZDLCQHKYAGIM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |