C19H21ClN2O5S — CID 2529890
methyl 3-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]amino]benzoate (PubChem CID 2529890) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is methyl 3-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 2529890 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | methyl 3-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-19(2,3)22-28(25,26)16-11-12(8-9-15(16)20)17(23)21-14-7-5-6-13(10-14)18(24)27-4/h5-11,22H,1-4H3,(H,21,23) |
| InChIKey | PCFOUJQRGWWNQX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |