C17H20ClN3O3S — CID 35344934
3-(tert-butylsulfamoyl)-4-chloro-N-(4-methyl-2-pyridinyl)benzamide (PubChem CID 35344934) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-chloro-N-(4-methyl-2-pyridinyl)benzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-4-chloro-N-(4-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 35344934 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-chloro-N-(4-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1ccnc(NC(=O)c2ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C17H20ClN3O3S/c1-11-7-8-19-15(9-11)20-16(22)12-5-6-13(18)14(10-12)25(23,24)21-17(2,3)4/h5-10,21H,1-4H3,(H,19,20,22) |
| InChIKey | YFKRAJIEEYUIOV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |