C21H27ClN2O5S — CID 38207231
3-(tert-butylsulfamoyl)-4-chloro-N-(3,4-diethoxyphenyl)benzamide (PubChem CID 38207231) has the molecular formula C21H27ClN2O5S and a molecular weight of 454.98 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-chloro-N-(3,4-diethoxyphenyl)benzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-4-chloro-N-(3,4-diethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 38207231 |
| Molecular Formula | C21H27ClN2O5S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-chloro-N-(3,4-diethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c2)cc1OCC |
| InChI | InChI=1S/C21H27ClN2O5S/c1-6-28-17-11-9-15(13-18(17)29-7-2)23-20(25)14-8-10-16(22)19(12-14)30(26,27)24-21(3,4)5/h8-13,24H,6-7H2,1-5H3,(H,23,25) |
| InChIKey | LZIQAVPDACFGFG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |