C23H29ClN2O6S — CID 43009398
4-chloro-N-(3,4-diethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 43009398) has the molecular formula C23H29ClN2O6S and a molecular weight of 497.01 g/mol. Its IUPAC name is 4-chloro-N-(3,4-diethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | 4-chloro-N-(3,4-diethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 43009398 |
| Molecular Formula | C23H29ClN2O6S |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-chloro-N-(3,4-diethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CC(C)OC(C)C3)c2)cc1OCC |
| InChI | InChI=1S/C23H29ClN2O6S/c1-5-30-20-10-8-18(12-21(20)31-6-2)25-23(27)17-7-9-19(24)22(11-17)33(28,29)26-13-15(3)32-16(4)14-26/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,25,27) |
| InChIKey | PTZRJDBAWAOIIS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |