C13H15ClNO5S- — CID 2412224
4-chloro-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 2412224) has the molecular formula C13H15ClNO5S- and a molecular weight of 332.79 g/mol. Its IUPAC name is 4-chloro-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | 4-chloro-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 2412224 |
| Molecular Formula | C13H15ClNO5S- |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-chloro-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc(C(=O)[O-])ccc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C13H16ClNO5S/c1-8-6-15(7-9(2)20-8)21(18,19)12-5-10(13(16)17)3-4-11(12)14/h3-5,8-9H,6-7H2,1-2H3,(H,16,17)/p-1/t8-,9+ |
| InChIKey | OEQFUZRYEZVPSD-DTORHVGOSA-M |
| XLogP | 0.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |