C13H14Cl2NO5S- — CID 6987912
2,4-dichloro-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 6987912) has the molecular formula C13H14Cl2NO5S- and a molecular weight of 367.23 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | 2,4-dichloro-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 6987912 |
| Molecular Formula | C13H14Cl2NO5S- |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2,4-dichloro-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc(C(=O)[O-])c(Cl)cc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C13H15Cl2NO5S/c1-7-5-16(6-8(2)21-7)22(19,20)12-3-9(13(17)18)10(14)4-11(12)15/h3-4,7-8H,5-6H2,1-2H3,(H,17,18)/p-1/t7-,8+ |
| InChIKey | QJIWUZAKCHMZMA-OCAPTIKFSA-M |
| XLogP | 1.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |