C14H18NO6S- — CID 2361227
5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-methoxybenzoate (PubChem CID 2361227) has the molecular formula C14H18NO6S- and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-methoxybenzoate.
| Compound Name | 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-methoxybenzoate |
|---|---|
| PubChem CID | 2361227 |
| Molecular Formula | C14H18NO6S- |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-methoxybenzoate |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1C(=O)[O-] |
| InChI | InChI=1S/C14H19NO6S/c1-9-7-15(8-10(2)21-9)22(18,19)11-4-5-13(20-3)12(6-11)14(16)17/h4-6,9-10H,7-8H2,1-3H3,(H,16,17)/p-1/t9-,10+ |
| InChIKey | YJSPJLDQEQNAIU-AOOOYVTPSA-M |
| XLogP | -0.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |