C16H20NO6S- — CID 9160639
(E)-3-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-methoxyphenyl]prop-2-enoate (PubChem CID 9160639) has the molecular formula C16H20NO6S- and a molecular weight of 354.40 g/mol. Its IUPAC name is (E)-3-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-methoxyphenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 9160639 |
| Molecular Formula | C16H20NO6S- |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (E)-3-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-methoxyphenyl]prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)[O-])cc1S(=O)(=O)N1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C16H21NO6S/c1-11-9-17(10-12(2)23-11)24(20,21)15-8-13(5-7-16(18)19)4-6-14(15)22-3/h4-8,11-12H,9-10H2,1-3H3,(H,18,19)/p-1/b7-5+/t11-,12-/m0/s1 |
| InChIKey | PJDMAZRDQUCBAN-YILIYONBSA-M |
| XLogP | 0.26 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|