C16H21NO6S — CID 16642404
(E)-3-[3-(2,6-dimethylmorpholin-4-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 16642404) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is (E)-3-[3-(2,6-dimethylmorpholin-4-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(2,6-dimethylmorpholin-4-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 16642404 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (E)-3-[3-(2,6-dimethylmorpholin-4-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1S(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H21NO6S/c1-11-9-17(10-12(2)23-11)24(20,21)15-8-13(5-7-16(18)19)4-6-14(15)22-3/h4-8,11-12H,9-10H2,1-3H3,(H,18,19)/b7-5+ |
| InChIKey | PJDMAZRDQUCBAN-FNORWQNLSA-N |
| XLogP | 1.59 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|