C18H16ClNO5S — CID 167932004
(E)-3-[3-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 167932004) has the molecular formula C18H16ClNO5S and a molecular weight of 393.85 g/mol. Its IUPAC name is (E)-3-[3-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167932004 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (E)-3-[3-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1S(=O)(=O)N1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H16ClNO5S/c1-25-16-6-2-12(3-7-18(21)22)10-17(16)26(23,24)20-9-8-13-4-5-14(19)11-15(13)20/h2-7,10-11H,8-9H2,1H3,(H,21,22)/b7-3+ |
| InChIKey | IMLOUUSILPXLGO-XVNBXDOJSA-N |
| XLogP | 3.20 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|