C19H19ClN2O6S — CID 97455092
(Z)-3-[3-[[5-chloro-2-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 97455092) has the molecular formula C19H19ClN2O6S and a molecular weight of 438.89 g/mol. Its IUPAC name is (Z)-3-[3-[[5-chloro-2-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[3-[[5-chloro-2-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 97455092 |
| Molecular Formula | C19H19ClN2O6S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (Z)-3-[3-[[5-chloro-2-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C\C(=O)O)cc1S(=O)(=O)Nc1cc(Cl)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C19H19ClN2O6S/c1-22(2)19(25)14-7-6-13(20)11-15(14)21-29(26,27)17-10-12(5-9-18(23)24)4-8-16(17)28-3/h4-11,21H,1-3H3,(H,23,24)/b9-5- |
| InChIKey | MQMVWFIHWAYCRZ-UITAMQMPSA-N |
| XLogP | 2.95 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|