C16H17ClN2O5S — CID 26952518
N-[3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]acetamide (PubChem CID 26952518) has the molecular formula C16H17ClN2O5S and a molecular weight of 384.84 g/mol. Its IUPAC name is N-[3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 26952518 |
| Molecular Formula | C16H17ClN2O5S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(Cl)cc1NS(=O)(=O)c1cc(NC(C)=O)ccc1OC |
| InChI | InChI=1S/C16H17ClN2O5S/c1-10(20)18-12-5-7-15(24-3)16(9-12)25(21,22)19-13-8-11(17)4-6-14(13)23-2/h4-9,19H,1-3H3,(H,18,20) |
| InChIKey | KIWCTFMUPQOKAL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |