C15H14Cl2N2O5S — CID 25036035
N-[3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-methoxyphenyl]acetamide (PubChem CID 25036035) has the molecular formula C15H14Cl2N2O5S and a molecular weight of 405.26 g/mol. Its IUPAC name is N-[3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-methoxyphenyl]acetamide.
| Compound Name | N-[3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 25036035 |
| Molecular Formula | C15H14Cl2N2O5S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | N-[3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H14Cl2N2O5S/c1-8(20)18-10-3-4-13(24-2)12(7-10)19-25(22,23)14-6-9(16)5-11(17)15(14)21/h3-7,19,21H,1-2H3,(H,18,20) |
| InChIKey | YMASSFUVXJXVPM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|