C15H16ClNO5S — CID 3706982
5-chloro-N-(3,4-dimethoxyphenyl)-2-methoxybenzenesulfonamide (PubChem CID 3706982) has the molecular formula C15H16ClNO5S and a molecular weight of 357.82 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethoxyphenyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-(3,4-dimethoxyphenyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3706982 |
| Molecular Formula | C15H16ClNO5S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 5-chloro-N-(3,4-dimethoxyphenyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(Cl)ccc2OC)cc1OC |
| InChI | InChI=1S/C15H16ClNO5S/c1-20-12-7-5-11(9-14(12)22-3)17-23(18,19)15-8-10(16)4-6-13(15)21-2/h4-9,17H,1-3H3 |
| InChIKey | XPZFRURLRRMPKE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |