C13H12Cl2N2O5S2 — CID 4826414
5-[(2,5-dichlorophenyl)sulfonylamino]-2-methoxybenzenesulfonamide (PubChem CID 4826414) has the molecular formula C13H12Cl2N2O5S2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 5-[(2,5-dichlorophenyl)sulfonylamino]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[(2,5-dichlorophenyl)sulfonylamino]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 4826414 |
| Molecular Formula | C13H12Cl2N2O5S2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 5-[(2,5-dichlorophenyl)sulfonylamino]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H12Cl2N2O5S2/c1-22-11-5-3-9(7-13(11)23(16,18)19)17-24(20,21)12-6-8(14)2-4-10(12)15/h2-7,17H,1H3,(H2,16,18,19) |
| InChIKey | QMZIOFAKXTVLCE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |