C14H15BrN2O6S2 — CID 4832626
5-[(3-bromo-4-methoxyphenyl)sulfonylamino]-2-methoxybenzenesulfonamide (PubChem CID 4832626) has the molecular formula C14H15BrN2O6S2 and a molecular weight of 451.32 g/mol. Its IUPAC name is 5-[(3-bromo-4-methoxyphenyl)sulfonylamino]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[(3-bromo-4-methoxyphenyl)sulfonylamino]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 4832626 |
| Molecular Formula | C14H15BrN2O6S2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | 5-[(3-bromo-4-methoxyphenyl)sulfonylamino]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(OC)c(S(N)(=O)=O)c2)cc1Br |
| InChI | InChI=1S/C14H15BrN2O6S2/c1-22-12-6-4-10(8-11(12)15)25(20,21)17-9-3-5-13(23-2)14(7-9)24(16,18)19/h3-8,17H,1-2H3,(H2,16,18,19) |
| InChIKey | QPCKAFPODVWZQN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |