C20H19BrN2O5S2 — CID 39361432
3-bromo-4-methoxy-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 39361432) has the molecular formula C20H19BrN2O5S2 and a molecular weight of 511.42 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39361432 |
| Molecular Formula | C20H19BrN2O5S2 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 3-bromo-4-methoxy-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C)cc3)cc2)cc1Br |
| InChI | InChI=1S/C20H19BrN2O5S2/c1-14-3-5-15(6-4-14)22-29(24,25)17-9-7-16(8-10-17)23-30(26,27)18-11-12-20(28-2)19(21)13-18/h3-13,22-23H,1-2H3 |
| InChIKey | JVAMCOGHHNQQDE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |