C21H22N2O4S — CID 112986058
3,4-dimethoxy-N-[4-(4-methylanilino)phenyl]benzenesulfonamide (PubChem CID 112986058) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(4-methylanilino)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[4-(4-methylanilino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112986058 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(4-methylanilino)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Nc3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C21H22N2O4S/c1-15-4-6-16(7-5-15)22-17-8-10-18(11-9-17)23-28(24,25)19-12-13-20(26-2)21(14-19)27-3/h4-14,22-23H,1-3H3 |
| InChIKey | DWVFUGKXDUKARD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |