C17H20N2O4S — CID 112980172
3,4-dimethoxy-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide (PubChem CID 112980172) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112980172 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-4-11-18-13-5-7-14(8-6-13)19-24(20,21)15-9-10-16(22-2)17(12-15)23-3/h4-10,12,18-19H,1,11H2,2-3H3 |
| InChIKey | FJMURVGIDUATMQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|