C22H24N2O6S2 — CID 3801791
N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 3801791) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3801791 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3c(C)cccc3C)cc2)cc1OC |
| InChI | InChI=1S/C22H24N2O6S2/c1-15-6-5-7-16(2)22(15)24-31(25,26)18-10-8-17(9-11-18)23-32(27,28)19-12-13-20(29-3)21(14-19)30-4/h5-14,23-24H,1-4H3 |
| InChIKey | YASSJCNUDCSHQF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |