C21H22N2O7S2 — CID 3106646
4-methoxy-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-disulfonamide (PubChem CID 3106646) has the molecular formula C21H22N2O7S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-methoxy-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-disulfonamide.
| Compound Name | 4-methoxy-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 3106646 |
| Molecular Formula | C21H22N2O7S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-methoxy-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-disulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OC)c(S(=O)(=O)Nc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C21H22N2O7S2/c1-28-17-8-4-15(5-9-17)22-31(24,25)19-12-13-20(30-3)21(14-19)32(26,27)23-16-6-10-18(29-2)11-7-16/h4-14,22-23H,1-3H3 |
| InChIKey | WJRSVCLVBUQFEG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |