C15H18N2O6S2 — CID 24662891
2,5-dimethoxy-N-[4-(sulfamoylmethyl)phenyl]benzenesulfonamide (PubChem CID 24662891) has the molecular formula C15H18N2O6S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[4-(sulfamoylmethyl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[4-(sulfamoylmethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24662891 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2,5-dimethoxy-N-[4-(sulfamoylmethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(CS(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C15H18N2O6S2/c1-22-13-7-8-14(23-2)15(9-13)25(20,21)17-12-5-3-11(4-6-12)10-24(16,18)19/h3-9,17H,10H2,1-2H3,(H2,16,18,19) |
| InChIKey | QBWSOYUJYJPDQJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |