C21H21NO5S — CID 2208419
2,5-dimethoxy-N-(4-phenylmethoxyphenyl)benzenesulfonamide (PubChem CID 2208419) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(4-phenylmethoxyphenyl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(4-phenylmethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2208419 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2,5-dimethoxy-N-(4-phenylmethoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H21NO5S/c1-25-19-12-13-20(26-2)21(14-19)28(23,24)22-17-8-10-18(11-9-17)27-15-16-6-4-3-5-7-16/h3-14,22H,15H2,1-2H3 |
| InChIKey | VBYNASQQALFWFQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |