C15H14F3NO4S — CID 7342398
2,5-dimethoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 7342398) has the molecular formula C15H14F3NO4S and a molecular weight of 361.34 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7342398 |
| Molecular Formula | C15H14F3NO4S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2,5-dimethoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C15H14F3NO4S/c1-22-12-7-8-13(23-2)14(9-12)24(20,21)19-11-5-3-10(4-6-11)15(16,17)18/h3-9,19H,1-2H3 |
| InChIKey | CSCXMCJRSRADKU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |