C15H13ClF3NO4S — CID 1295813
N-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 1295813) has the molecular formula C15H13ClF3NO4S and a molecular weight of 395.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 1295813 |
| Molecular Formula | C15H13ClF3NO4S |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H13ClF3NO4S/c1-23-10-4-6-13(24-2)14(8-10)25(21,22)20-9-3-5-12(16)11(7-9)15(17,18)19/h3-8,20H,1-2H3 |
| InChIKey | TYAVXHMKIXARIU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |