C17H16ClF3N2O3 — CID 26438641
2-[4-chloro-3-(trifluoromethyl)anilino]-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 26438641) has the molecular formula C17H16ClF3N2O3 and a molecular weight of 388.77 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)anilino]-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26438641 |
| Molecular Formula | C17H16ClF3N2O3 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CNc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H16ClF3N2O3/c1-25-11-4-6-15(26-2)14(8-11)23-16(24)9-22-10-3-5-13(18)12(7-10)17(19,20)21/h3-8,22H,9H2,1-2H3,(H,23,24) |
| InChIKey | RBMNRQKZBYVQOS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |