C18H21ClN2O5 — CID 109009482
N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,5-dimethoxyanilino)acetamide (PubChem CID 109009482) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,5-dimethoxyanilino)acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,5-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 109009482 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,5-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(OC)c(NCC(=O)Nc2cc(OC)c(Cl)cc2OC)c1 |
| InChI | InChI=1S/C18H21ClN2O5/c1-23-11-5-6-15(24-2)13(7-11)20-10-18(22)21-14-9-16(25-3)12(19)8-17(14)26-4/h5-9,20H,10H2,1-4H3,(H,21,22) |
| InChIKey | XCGDKYJGFWFKJP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |