C19H24N2O6 — CID 51178370
N-(2,5-dimethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 51178370) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 51178370 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CNc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H24N2O6/c1-23-13-6-7-15(24-2)14(10-13)21-18(22)11-20-12-8-16(25-3)19(27-5)17(9-12)26-4/h6-10,20H,11H2,1-5H3,(H,21,22) |
| InChIKey | VZRBVKGGJBMUFS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|