C18H21ClN2O3 — CID 109007659
2-(4-chloro-2,5-dimethoxyanilino)-N-(2-ethylphenyl)acetamide (PubChem CID 109007659) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 109007659 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CNc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C18H21ClN2O3/c1-4-12-7-5-6-8-14(12)21-18(22)11-20-15-10-16(23-2)13(19)9-17(15)24-3/h5-10,20H,4,11H2,1-3H3,(H,21,22) |
| InChIKey | ALYVZSYRRWFBHM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |