C17H16ClN3O3 — CID 109011243
N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-cyanoanilino)acetamide (PubChem CID 109011243) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-cyanoanilino)acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-cyanoanilino)acetamide |
|---|---|
| PubChem CID | 109011243 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-cyanoanilino)acetamide |
| SMILES | COc1cc(NC(=O)CNc2ccccc2C#N)c(OC)cc1Cl |
| InChI | InChI=1S/C17H16ClN3O3/c1-23-15-8-14(16(24-2)7-12(15)18)21-17(22)10-20-13-6-4-3-5-11(13)9-19/h3-8,20H,10H2,1-2H3,(H,21,22) |
| InChIKey | YTSLSGYAVLZBBH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |