C16H15ClF2N2O3 — CID 31054802
2-(4-chloro-2,5-dimethoxyanilino)-N-(2,6-difluorophenyl)acetamide (PubChem CID 31054802) has the molecular formula C16H15ClF2N2O3 and a molecular weight of 356.76 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 31054802 |
| Molecular Formula | C16H15ClF2N2O3 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2,6-difluorophenyl)acetamide |
| SMILES | COc1cc(NCC(=O)Nc2c(F)cccc2F)c(OC)cc1Cl |
| InChI | InChI=1S/C16H15ClF2N2O3/c1-23-13-7-12(14(24-2)6-9(13)17)20-8-15(22)21-16-10(18)4-3-5-11(16)19/h3-7,20H,8H2,1-2H3,(H,21,22) |
| InChIKey | YQXKMCWCCUYORW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |