C16H15Cl3N2O3 — CID 9106808
2-(4-chloro-2,5-dimethoxyanilino)-N-(3,4-dichlorophenyl)acetamide (PubChem CID 9106808) has the molecular formula C16H15Cl3N2O3 and a molecular weight of 389.67 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 9106808 |
| Molecular Formula | C16H15Cl3N2O3 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(3,4-dichlorophenyl)acetamide |
| SMILES | COc1cc(NCC(=O)Nc2ccc(Cl)c(Cl)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C16H15Cl3N2O3/c1-23-14-7-13(15(24-2)6-12(14)19)20-8-16(22)21-9-3-4-10(17)11(18)5-9/h3-7,20H,8H2,1-2H3,(H,21,22) |
| InChIKey | QWNKDBJFSYNKNQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |