C15H12Cl4N2O2 — CID 54816552
N-(3-chloro-4-methoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 54816552) has the molecular formula C15H12Cl4N2O2 and a molecular weight of 394.09 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 54816552 |
| Molecular Formula | C15H12Cl4N2O2 |
| Molecular Weight | 394.09 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2cc(Cl)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl4N2O2/c1-23-14-3-2-8(4-12(14)19)21-15(22)7-20-13-6-10(17)9(16)5-11(13)18/h2-6,20H,7H2,1H3,(H,21,22) |
| InChIKey | KKSHDZXRPHMXLL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.09 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|