C15H14ClIN2O2 — CID 26509562
2-(3-chloro-4-methoxyanilino)-N-(4-iodophenyl)acetamide (PubChem CID 26509562) has the molecular formula C15H14ClIN2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 26509562 |
| Molecular Formula | C15H14ClIN2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-N-(4-iodophenyl)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccc(I)cc2)cc1Cl |
| InChI | InChI=1S/C15H14ClIN2O2/c1-21-14-7-6-12(8-13(14)16)18-9-15(20)19-11-4-2-10(17)3-5-11/h2-8,18H,9H2,1H3,(H,19,20) |
| InChIKey | OFANIRBDDHOIST-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|