C17H18ClN3O4 — CID 46633585
4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]benzamide (PubChem CID 46633585) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 46633585 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]benzamide |
| SMILES | COc1cc(NCC(=O)Nc2ccc(C(N)=O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O4/c1-24-14-8-13(15(25-2)7-12(14)18)20-9-16(22)21-11-5-3-10(4-6-11)17(19)23/h3-8,20H,9H2,1-2H3,(H2,19,23)(H,21,22) |
| InChIKey | IWDGVBYFVMGSPF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |