C17H18ClN3O5S — CID 22305357
4-[[2-(5-chloro-2-methoxy-3-methylsulfonylanilino)acetyl]amino]benzamide (PubChem CID 22305357) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is 4-[[2-(5-chloro-2-methoxy-3-methylsulfonylanilino)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(5-chloro-2-methoxy-3-methylsulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 22305357 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-[[2-(5-chloro-2-methoxy-3-methylsulfonylanilino)acetyl]amino]benzamide |
| SMILES | COc1c(NCC(=O)Nc2ccc(C(N)=O)cc2)cc(Cl)cc1S(C)(=O)=O |
| InChI | InChI=1S/C17H18ClN3O5S/c1-26-16-13(7-11(18)8-14(16)27(2,24)25)20-9-15(22)21-12-5-3-10(4-6-12)17(19)23/h3-8,20H,9H2,1-2H3,(H2,19,23)(H,21,22) |
| InChIKey | AWYSYVNJPPQUSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |