C15H16ClN3O5S2 — CID 56578585
N-(4-chlorophenyl)-2-(2-methylsulfonyl-4-sulfamoylanilino)acetamide (PubChem CID 56578585) has the molecular formula C15H16ClN3O5S2 and a molecular weight of 417.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2-methylsulfonyl-4-sulfamoylanilino)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(2-methylsulfonyl-4-sulfamoylanilino)acetamide |
|---|---|
| PubChem CID | 56578585 |
| Molecular Formula | C15H16ClN3O5S2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2-methylsulfonyl-4-sulfamoylanilino)acetamide |
| SMILES | CS(=O)(=O)c1cc(S(N)(=O)=O)ccc1NCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3O5S2/c1-25(21,22)14-8-12(26(17,23)24)6-7-13(14)18-9-15(20)19-11-4-2-10(16)3-5-11/h2-8,18H,9H2,1H3,(H,19,20)(H2,17,23,24) |
| InChIKey | FKYIBGOWWJPMDN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |