C21H26ClN3O4 — CID 26531357
4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]-N,N-diethylbenzamide (PubChem CID 26531357) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is 4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 26531357 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[[2-(4-chloro-2,5-dimethoxyanilino)acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNc2cc(OC)c(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C21H26ClN3O4/c1-5-25(6-2)21(27)14-7-9-15(10-8-14)24-20(26)13-23-17-12-18(28-3)16(22)11-19(17)29-4/h7-12,23H,5-6,13H2,1-4H3,(H,24,26) |
| InChIKey | MPTFBKOZBSFQDL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |