C26H27N3O4 — CID 42068388
N,N-diethyl-4-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]benzamide (PubChem CID 42068388) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 42068388 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N,N-diethyl-4-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNc2cc3oc4ccccc4c3cc2OC)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-4-29(5-2)26(31)17-10-12-18(13-11-17)28-25(30)16-27-21-15-23-20(14-24(21)32-3)19-8-6-7-9-22(19)33-23/h6-15,27H,4-5,16H2,1-3H3,(H,28,30) |
| InChIKey | YRBPRTKSQJAJNQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_A(4)', 'substructure': 'N/A'} |
|---|