C25H25N3O5S — CID 42068320
2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 42068320) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42068320 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | COc1cc2c(cc1NCC(=O)Nc1cccc(S(=O)(=O)N3CCCC3)c1)oc1ccccc12 |
| InChI | InChI=1S/C25H25N3O5S/c1-32-24-14-20-19-9-2-3-10-22(19)33-23(20)15-21(24)26-16-25(29)27-17-7-6-8-18(13-17)34(30,31)28-11-4-5-12-28/h2-3,6-10,13-15,26H,4-5,11-12,16H2,1H3,(H,27,29) |
| InChIKey | KSEWIJLHONESMV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_A(4)', 'substructure': 'N/A'} |
|---|